EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO2S2 |
| Net Charge | 0 |
| Average Mass | 153.228 |
| Monoisotopic Mass | 152.99182 |
| SMILES | [NH3+][C@@H](CSS)C(=O)[O-] |
| InChI | InChI=1S/C3H7NO2S2/c4-2(1-8-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1 |
| InChIKey | XBKONSCREBSMCS-REOHCLBHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-disulfanyl-L-alanine zwitterion (CHEBI:58591) is a amino-acid zwitterion (CHEBI:35238) |
| 3-disulfanyl-L-alanine zwitterion (CHEBI:58591) is tautomer of 3-disulfanyl-L-alanine (CHEBI:28839) |
| Incoming Relation(s) |
| 3-disulfanyl-L-alanine (CHEBI:28839) is tautomer of 3-disulfanyl-L-alanine zwitterion (CHEBI:58591) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-disulfanylpropanoate |
| UniProt Name | Source |
|---|---|
| S-sulfanyl-L-cysteine | UniProt |