EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O6 |
| Net Charge | 0 |
| Average Mass | 288.255 |
| Monoisotopic Mass | 288.06339 |
| SMILES | O=C1c2ccc(O)cc2O[C@H](c2ccc(O)c(O)c2)[C@H]1O |
| InChI | InChI=1S/C15H12O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,14-18,20H/t14-,15+/m0/s1 |
| InChIKey | FNUPUYFWZXZMIE-LSDHHAIUSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-trans-fustin (CHEBI:228234) is a fustin (CHEBI:5202) |
| Incoming Relation(s) |
| (±)-trans-fustin (CHEBI:228236) has part (+)-trans-fustin (CHEBI:228234) |
| IUPAC Name |
|---|
| (2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (+)-2,3-dihydrofisetin | ChEBI |
| (2R,3R)-2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,7-dihydroxy-4H-1-benzopyran-4-one | ChEBI |
| (2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydro-4H-1-benzopyran-4-one | IUPAC |
| (2R,3R)-3,7,3',4'-tetrahydroxyflavanone | ChEBI |
| (2R,3R)-fustin | ChEBI |
| (2R-trans)-2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,7-dihydroxy-4H-1-benzopyran-4-one | ChEBI |