EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O7P2 |
| Net Charge | 0 |
| Average Mass | 246.092 |
| Monoisotopic Mass | 246.00583 |
| SMILES | C=C(C)CCOP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C5H12O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8/h1,3-4H2,2H3,(H,9,10)(H2,6,7,8) |
| InChIKey | NUHSROFQTUXZQQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). phosphoantigen Any antigen that is a phosphorylated microbial metabolite which activates an immune response in humans. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isopentenyl diphosphate (CHEBI:16584) has role Escherichia coli metabolite (CHEBI:76971) |
| isopentenyl diphosphate (CHEBI:16584) has role antigen (CHEBI:59132) |
| isopentenyl diphosphate (CHEBI:16584) has role antioxidant (CHEBI:22586) |
| isopentenyl diphosphate (CHEBI:16584) has role epitope (CHEBI:53000) |
| isopentenyl diphosphate (CHEBI:16584) has role mouse metabolite (CHEBI:75771) |
| isopentenyl diphosphate (CHEBI:16584) has role phosphoantigen (CHEBI:59544) |
| isopentenyl diphosphate (CHEBI:16584) is a prenol phosphate (CHEBI:26250) |
| isopentenyl diphosphate (CHEBI:16584) is conjugate acid of isopentenyl diphosphate(3−) (CHEBI:128769) |
| Incoming Relation(s) |
| isopentenyl diphosphate(3−) (CHEBI:128769) is conjugate base of isopentenyl diphosphate (CHEBI:16584) |
| IUPAC Name |
|---|
| 3-methylbut-3-en-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| 3-Methyl-3-butenyl pyrophosphate | ChemIDplus |
| 3-methylbut-3-en-1-yl trihydrogen diphosphate | PDBeChem |
| 3-methylbut-3-enyl phosphono hydrogen phosphate | PDBeChem |
| delta3-isopentenyl diphosphate | ChEBI |
| delta3-Isopentenyl diphosphate | KEGG COMPOUND |
| delta-3-Isopentenyl pyrophosphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00000848 | KNApSAcK |
| C00129 | KEGG COMPOUND |
| C00129 | KEGG COMPOUND |
| DB04714 | DrugBank |
| IPE | PDBeChem |
| Isopentenyl pyrophosphate | Wikipedia |
| LMPR01010008 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1713792 | Reaxys |
| CAS:358-71-4 | KEGG COMPOUND |
| CAS:358-71-4 | ChemIDplus |
| Citations |
|---|