EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:128769 - isopentenyl diphosphate(3−)
| Formula | C5H9O7P2 |
| Net Charge | -3 |
| Average Mass | 243.068 |
| Monoisotopic Mass | 242.98400 |
| SMILES | C=C(C)CCOP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C5H12O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8/h1,3-4H2,2H3,(H,9,10)(H2,6,7,8)/p-3 |
| InChIKey | NUHSROFQTUXZQQ-UHFFFAOYSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). phosphoantigen Any antigen that is a phosphorylated microbial metabolite which activates an immune response in humans. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isopentenyl diphosphate(3−) (CHEBI:128769) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| isopentenyl diphosphate(3−) (CHEBI:128769) has role epitope (CHEBI:53000) |
| isopentenyl diphosphate(3−) (CHEBI:128769) has role human metabolite (CHEBI:77746) |
| isopentenyl diphosphate(3−) (CHEBI:128769) has role phosphoantigen (CHEBI:59544) |
| isopentenyl diphosphate(3−) (CHEBI:128769) is a organophosphate oxoanion (CHEBI:58945) |
| isopentenyl diphosphate(3−) (CHEBI:128769) is conjugate base of isopentenyl diphosphate (CHEBI:16584) |
| Incoming Relation(s) |
| isopentenyl diphosphate (CHEBI:16584) is conjugate acid of isopentenyl diphosphate(3−) (CHEBI:128769) |
| IUPAC Name |
|---|
| 3-methylbut-3-en-1-yl diphosphate |
| Synonyms | Source |
|---|---|
| 3-methylbut-3-enyl diphosphate | ChEBI |
| 3-methylbut-3-enyl diphosphate trianion | ChEBI |
| 3-methylbut-3-enyl pyrophosphate | ChEBI |
| isopentenyl pyrophosphate | ChEBI |
| UniProt Name | Source |
|---|---|
| isopentenyl diphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1824090 | Reaxys |
| Citations |
|---|