EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O14 |
| Net Charge | 0 |
| Average Mass | 578.523 |
| Monoisotopic Mass | 578.16356 |
| SMILES | C[C@@H]1O[C@@H](c2c(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O14/c1-8-17(31)21(35)23(37)27(39-8)16-20(34)15(26-24(38)22(36)18(32)13(7-28)41-26)19(33)14-11(30)6-12(40-25(14)16)9-2-4-10(29)5-3-9/h2-6,8,13,17-18,21-24,26-29,31-38H,7H2,1H3/t8-,13+,17-,18+,21+,22-,23+,24+,26-,27-/m0/s1 |
| InChIKey | MVOUGOXRXQDXDC-RSPRXDBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Viola tricolor (ncbitaxon:214053) | - | DOI (10.1016/S0040-4039(00)90113-8) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| violanthin (CHEBI:9992) has functional parent flavone (CHEBI:42491) |
| violanthin (CHEBI:9992) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| violanthin (CHEBI:9992) has role plant metabolite (CHEBI:76924) |
| violanthin (CHEBI:9992) is a flavone C-glycoside (CHEBI:83280) |
| violanthin (CHEBI:9992) is a trihydroxyflavone (CHEBI:27116) |
| Manual Xrefs | Databases |
|---|---|
| C10196 | KEGG COMPOUND |
| C00006230 | KNApSAcK |
| LMPK12110219 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6555620 | Reaxys |
| CAS:40581-17-7 | KEGG COMPOUND |
| Citations |
|---|