EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9992 - violanthin
| Formula | C27H30O14 |
| Net Charge | 0 |
| Average Mass | 578.523 |
| Monoisotopic Mass | 578.16356 |
| SMILES | C[C@@H]1O[C@@H](c2c(O)c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O14/c1-8-17(31)21(35)23(37)27(39-8)16-20(34)15(26-24(38)22(36)18(32)13(7-28)41-26)19(33)14-11(30)6-12(40-25(14)16)9-2-4-10(29)5-3-9/h2-6,8,13,17-18,21-24,26-29,31-38H,7H2,1H3/t8-,13+,17-,18+,21+,22-,23+,24+,26-,27-/m0/s1 |
| InChIKey | MVOUGOXRXQDXDC-RSPRXDBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Viola tricolor (ncbitaxon:214053) | - | DOI (10.1016/S0040-4039(00)90113-8) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| violanthin (CHEBI:9992) has functional parent flavone (CHEBI:42491) |
| violanthin (CHEBI:9992) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| violanthin (CHEBI:9992) has role plant metabolite (CHEBI:76924) |
| violanthin (CHEBI:9992) is a flavone C-glycoside (CHEBI:83280) |
| violanthin (CHEBI:9992) is a trihydroxyflavone (CHEBI:27116) |
| Manual Xrefs | Databases |
|---|---|
| C00006230 | KNApSAcK |
| C10196 | KEGG COMPOUND |
| LMPK12110219 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6555620 | Reaxys |
| CAS:40581-17-7 | KEGG COMPOUND |
| Citations |
|---|