EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9970 - Verticine
| Formula | C27H45NO3 |
| Net Charge | 0 |
| Average Mass | 431.661 |
| Monoisotopic Mass | 431.33994 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@](C)(O)[C@]4([H])CC[C@H](C)CN4C[C@@]3([H])[C@]1([H])C[C@@]1([H])[C@@]2([H])C[C@H](O)[C@@]2([H])C[C@@H](O)CC[C@]12C |
| InChI | InChI=1S/C27H45NO3/c1-15-4-7-25-27(3,31)21-6-5-17-18(20(21)14-28(25)13-15)11-22-19(17)12-24(30)23-10-16(29)8-9-26(22,23)2/h15-25,29-31H,4-14H2,1-3H3/t15-,16-,17+,18+,19-,20-,21-,22-,23+,24-,25-,26+,27-/m0/s1 |
| InChIKey | IUKLSMSEHKDIIP-BZMYINFQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Verticine (CHEBI:9970) is a alkaloid (CHEBI:22315) |
| Synonyms | Source |
|---|---|
| Verticine | KEGG COMPOUND |
| Verticine | KEGG COMPOUND |