EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O7 |
| Net Charge | 0 |
| Average Mass | 368.341 |
| Monoisotopic Mass | 368.08960 |
| SMILES | C=C(C)C1Cc2c(cc3oc(-c4ccc(O)c(O)c4)c(O)c(=O)c3c2O)O1 |
| InChI | InChI=1S/C20H16O7/c1-8(2)13-6-10-14(26-13)7-15-16(17(10)23)18(24)19(25)20(27-15)9-3-4-11(21)12(22)5-9/h3-5,7,13,21-23,25H,1,6H2,2H3 |
| InChIKey | YFDRNZOCVRPNBL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| velloquercetin (CHEBI:9941) has functional parent quercetin (CHEBI:16243) |
| velloquercetin (CHEBI:9941) has role metabolite (CHEBI:25212) |
| velloquercetin (CHEBI:9941) has role plant metabolite (CHEBI:76924) |
| velloquercetin (CHEBI:9941) is a extended flavonoid (CHEBI:71037) |
| velloquercetin (CHEBI:9941) is a flavonols (CHEBI:28802) |
| velloquercetin (CHEBI:9941) is a furochromene (CHEBI:39432) |
| velloquercetin (CHEBI:9941) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 7-(3,4-dihydroxyphenyl)-4,6-dihydroxy-2-(prop-1-en-2-yl)-2,3-dihydro-5H-furo[3,2-g]chromen-5-one |
| Synonym | Source |
|---|---|
| 2''-isopropenyldihydrofurano(4'',5'':6,7)quercetin | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00005099 | KNApSAcK |
| C10194 | KEGG COMPOUND |
| LMPK12112283 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5360077 | Reaxys |
| CAS:139955-63-8 | KEGG COMPOUND |