EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29N5O3 |
| Net Charge | 0 |
| Average Mass | 435.528 |
| Monoisotopic Mass | 435.22704 |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2-c2nnnn2)cc1)[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C24H29N5O3/c1-4-5-10-21(30)29(22(16(2)3)24(31)32)15-17-11-13-18(14-12-17)19-8-6-7-9-20(19)23-25-27-28-26-23/h6-9,11-14,16,22H,4-5,10,15H2,1-3H3,(H,31,32)(H,25,26,27,28)/t22-/m0/s1 |
| InChIKey | ACWBQPMHZXGDFX-QFIPXVFZSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| valsartan (CHEBI:9927) has role angiotensin receptor antagonist (CHEBI:61016) |
| valsartan (CHEBI:9927) has role antihypertensive agent (CHEBI:35674) |
| valsartan (CHEBI:9927) has role environmental contaminant (CHEBI:78298) |
| valsartan (CHEBI:9927) has role xenobiotic (CHEBI:35703) |
| valsartan (CHEBI:9927) is a biphenylyltetrazole (CHEBI:48420) |
| valsartan (CHEBI:9927) is a monocarboxylic acid (CHEBI:25384) |
| valsartan (CHEBI:9927) is a monocarboxylic acid amide (CHEBI:29347) |
| Incoming Relation(s) |
| Byvalson (CHEBI:132911) has part valsartan (CHEBI:9927) |
| IUPAC Name |
|---|
| N-pentanoyl-N-{[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl}-L-valine |
| INN | Source |
|---|---|
| valsartan | ChemIDplus |
| Synonyms | Source |
|---|---|
| Diovan | KEGG DRUG |
| N-(p-(o-1H-tetrazol-5-ylphenyl)benzyl)-N-valeryl-L-valine | ChemIDplus |
| N-pentanoyl-N-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-L-valine | IUPAC |
| (S)-N-valeryl-N-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]-methyl}-valine | IUPHAR |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7754038 | Reaxys |
| CAS:137862-53-4 | ChemIDplus |