EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H23NO3 |
| Net Charge | 0 |
| Average Mass | 241.331 |
| Monoisotopic Mass | 241.16779 |
| SMILES | CC(C)CC(=O)O[C@@H]1CC2C[C@@H](O)C(C1)N2C |
| InChI | InChI=1S/C13H23NO3/c1-8(2)4-13(16)17-10-5-9-6-12(15)11(7-10)14(9)3/h8-12,15H,4-7H2,1-3H3/t9?,10-,11?,12-/m1/s1 |
| InChIKey | APLLVFVOTXZBFO-RUJICJSRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Valeroidine (CHEBI:9923) is a tropane alkaloid (CHEBI:37332) |
| Synonym | Source |
|---|---|
| Valeroidine | KEGG COMPOUND |