EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O4 |
| Net Charge | 0 |
| Average Mass | 326.392 |
| Monoisotopic Mass | 326.15181 |
| SMILES | CC1=C(C)C2=CC(=O)c3c(O)c4c(c(O)c3[C@@]2(C)CC1)O[C@@H](C)C4 |
| InChI | InChI=1S/C20H22O4/c1-9-5-6-20(4)13(11(9)3)8-14(21)15-16(20)18(23)19-12(17(15)22)7-10(2)24-19/h8,10,22-23H,5-7H2,1-4H3/t10-,20-/m0/s1 |
| InChIKey | IQGPVLVWUUPQMQ-FVINQWEUSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Uncinatone (CHEBI:9861) is a phenanthrenes (CHEBI:25961) |
| Synonym | Source |
|---|---|
| Uncinatone | KEGG COMPOUND |