EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N4O4 |
| Net Charge | 0 |
| Average Mass | 422.485 |
| Monoisotopic Mass | 422.19541 |
| SMILES | O=C([C@@H]1[C@@H](CO)[C@@H]2Cn3c(cccc3=O)[C@H]1N2C(=O)c1ccccn1)N1CCCCC1 |
| InChI | InChI=1S/C23H26N4O4/c28-14-15-18-13-26-17(8-6-9-19(26)29)21(20(15)23(31)25-11-4-1-5-12-25)27(18)22(30)16-7-2-3-10-24-16/h2-3,6-10,15,18,20-21,28H,1,4-5,11-14H2/t15-,18-,20+,21+/m0/s1 |
| InChIKey | NNGWCWYYPXSIHJ-GDVKCFTOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-9231 (CHEBI:97852) is a aromatic carboxylic acid (CHEBI:33859) |
| LSM-9231 (CHEBI:97852) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Manual Xrefs | Databases |
|---|---|
| LSM-9231 | LINCS |