EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O4 |
| Net Charge | 0 |
| Average Mass | 290.359 |
| Monoisotopic Mass | 290.15181 |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(\C)C[C@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C17H22O4/c1-10-6-5-7-11(2)9-15-16(12(3)17(19)21-15)14(8-10)20-13(4)18/h6,9,14-16H,3,5,7-8H2,1-2,4H3/b10-6+,11-9+/t14-,15+,16+/m0/s1 |
| InChIKey | UPNVKIZABMRHNR-DUUXJKDPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Liriodendron tulipifera (ncbitaxon:3415) | root (BTO:0001188) | PubMed (5810209) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tulipinolide (CHEBI:9776) has role allergen (CHEBI:50904) |
| tulipinolide (CHEBI:9776) has role metabolite (CHEBI:25212) |
| tulipinolide (CHEBI:9776) is a germacranolide (CHEBI:73011) |
| IUPAC Name |
|---|
| (3aR,4S,6E,10E,11aR)-6,10-dimethyl-3-methylidene-2-oxo-2,3,3a,4,5,8,9,11a-octahydrocyclodeca[b]furan-4-yl acetate |
| Synonyms | Source |
|---|---|
| Tulipinolide | KEGG COMPOUND |
| epitulipinolide | ChemIDplus |
| 8α-acetoxycostunolide | ChEBI |
| Citations |
|---|