EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H15F3N4O3 |
| Net Charge | 0 |
| Average Mass | 416.359 |
| Monoisotopic Mass | 416.10963 |
| SMILES | [H][C@@]12CN(c3nc4c(cc3F)c(=O)c(C(=O)O)cn4-c3ccc(F)cc3F)C[C@]1([H])[C@H]2N |
| InChI | InChI=1S/C20H15F3N4O3/c21-8-1-2-15(13(22)3-8)27-7-12(20(29)30)17(28)9-4-14(23)19(25-18(9)27)26-5-10-11(6-26)16(10)24/h1-4,7,10-11,16H,5-6,24H2,(H,29,30)/t10-,11+,16+ |
| InChIKey | WVPSKSLAZQPAKQ-CDMJZVDBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antibacterial drug A drug used to treat or prevent bacterial infections. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trovafloxacin (CHEBI:9763) has role antibacterial drug (CHEBI:36047) |
| trovafloxacin (CHEBI:9763) has role antimicrobial agent (CHEBI:33281) |
| trovafloxacin (CHEBI:9763) has role DNA synthesis inhibitor (CHEBI:59517) |
| trovafloxacin (CHEBI:9763) has role hepatotoxic agent (CHEBI:50908) |
| trovafloxacin (CHEBI:9763) has role topoisomerase IV inhibitor (CHEBI:53559) |
| trovafloxacin (CHEBI:9763) is a 1,8-naphthyridine derivative (CHEBI:73537) |
| trovafloxacin (CHEBI:9763) is a amino acid (CHEBI:33709) |
| trovafloxacin (CHEBI:9763) is a azabicycloalkane (CHEBI:38295) |
| trovafloxacin (CHEBI:9763) is a difluorobenzene (CHEBI:38582) |
| trovafloxacin (CHEBI:9763) is a fluoroquinolone antibiotic (CHEBI:87211) |
| trovafloxacin (CHEBI:9763) is a monocarboxylic acid (CHEBI:25384) |
| trovafloxacin (CHEBI:9763) is a primary amino compound (CHEBI:50994) |
| trovafloxacin (CHEBI:9763) is a quinolone antibiotic (CHEBI:86324) |
| trovafloxacin (CHEBI:9763) is a tertiary amino compound (CHEBI:50996) |
| trovafloxacin (CHEBI:9763) is conjugate base of trovafloxacin(1+) (CHEBI:77569) |
| Incoming Relation(s) |
| trovafloxacin(1+) (CHEBI:77569) is conjugate acid of trovafloxacin (CHEBI:9763) |
| IUPAC Name |
|---|
| 7-[(1R,5S,6s)-6-amino-3-azabicyclo[3.1.0]hex-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
| INNs | Source |
|---|---|
| trovafloxacin | KEGG DRUG |
| trovafloxacine | WHO MedNet |
| trovafloxacino | WHO MedNet |
| trovafloxacinum | WHO MedNet |
| Manual Xrefs | Databases |
|---|---|
| 2777 | DrugCentral |
| C07664 | KEGG COMPOUND |
| D08654 | KEGG DRUG |
| DB00685 | DrugBank |
| HMDB0014823 | HMDB |
| Trovafloxacin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8172628 | Reaxys |
| CAS:147059-72-1 | KEGG COMPOUND |
| CAS:147059-72-1 | ChemIDplus |
| Citations |
|---|