EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9763 - trovafloxacin
| Formula | C20H15F3N4O3 |
| Net Charge | 0 |
| Average Mass | 416.359 |
| Monoisotopic Mass | 416.10963 |
| SMILES | [H][C@@]12CN(c3nc4c(cc3F)c(=O)c(C(=O)O)cn4-c3ccc(F)cc3F)C[C@]1([H])[C@H]2N |
| InChI | InChI=1S/C20H15F3N4O3/c21-8-1-2-15(13(22)3-8)27-7-12(20(29)30)17(28)9-4-14(23)19(25-18(9)27)26-5-10-11(6-26)16(10)24/h1-4,7,10-11,16H,5-6,24H2,(H,29,30)/t10-,11+,16+ |
| InChIKey | WVPSKSLAZQPAKQ-CDMJZVDBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trovafloxacin (CHEBI:9763) has role antibacterial agent (CHEBI:33282) |
| trovafloxacin (CHEBI:9763) has role antibacterial drug (CHEBI:36047) |
| trovafloxacin (CHEBI:9763) has role antimicrobial agent (CHEBI:33281) |
| trovafloxacin (CHEBI:9763) has role DNA synthesis inhibitor (CHEBI:59517) |
| trovafloxacin (CHEBI:9763) has role hepatotoxic agent (CHEBI:50908) |
| trovafloxacin (CHEBI:9763) has role topoisomerase IV inhibitor (CHEBI:53559) |
| trovafloxacin (CHEBI:9763) is a 1,8-naphthyridine derivative (CHEBI:73537) |
| trovafloxacin (CHEBI:9763) is a amino acid (CHEBI:33709) |
| trovafloxacin (CHEBI:9763) is a azabicycloalkane (CHEBI:38295) |
| trovafloxacin (CHEBI:9763) is a difluorobenzene (CHEBI:38582) |
| trovafloxacin (CHEBI:9763) is a fluoroquinolone antibiotic (CHEBI:87211) |
| trovafloxacin (CHEBI:9763) is a monocarboxylic acid (CHEBI:25384) |
| trovafloxacin (CHEBI:9763) is a primary amino compound (CHEBI:50994) |
| trovafloxacin (CHEBI:9763) is a quinolone antibiotic (CHEBI:86324) |
| trovafloxacin (CHEBI:9763) is a tertiary amino compound (CHEBI:50996) |
| trovafloxacin (CHEBI:9763) is conjugate base of trovafloxacin(1+) (CHEBI:77569) |
| Incoming Relation(s) |
| trovafloxacin(1+) (CHEBI:77569) is conjugate acid of trovafloxacin (CHEBI:9763) |
| IUPAC Name |
|---|
| 7-[(1R,5S,6s)-6-amino-3-azabicyclo[3.1.0]hex-3-yl]-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid |
| INNs | Source |
|---|---|
| trovafloxacin | KEGG DRUG |
| trovafloxacine | WHO MedNet |
| trovafloxacino | WHO MedNet |
| trovafloxacinum | WHO MedNet |
| Synonym | Source |
|---|---|
| CP-99219 | ChEMBL |
| Brand Name | Source |
|---|---|
| Turvel | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2777 | DrugCentral |
| C07664 | KEGG COMPOUND |
| D08654 | KEGG DRUG |
| DB00685 | DrugBank |
| HMDB0014823 | HMDB |
| Trovafloxacin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8172628 | Reaxys |
| CAS:147059-72-1 | ChemIDplus |
| CAS:147059-72-1 | KEGG COMPOUND |
| Citations |
|---|