EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2O2 |
| Net Charge | 0 |
| Average Mass | 284.359 |
| Monoisotopic Mass | 284.15248 |
| SMILES | CCN(Cc1ccncc1)C(=O)C(CO)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O2/c1-2-19(12-14-8-10-18-11-9-14)17(21)16(13-20)15-6-4-3-5-7-15/h3-11,16,20H,2,12-13H2,1H3 |
| InChIKey | BGDKAVGWHJFAGW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antiparkinson drug A drug used in the treatment of Parkinson's disease. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tropicamide (CHEBI:9757) has role antihypertensive agent (CHEBI:35674) |
| Tropicamide (CHEBI:9757) has role antiparkinson drug (CHEBI:48407) |
| Tropicamide (CHEBI:9757) has role ophthalmology drug (CHEBI:66981) |
| Tropicamide (CHEBI:9757) is a acetamides (CHEBI:22160) |
| INN | Source |
|---|---|
| tropicamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| bistropamide | DrugCentral |
| epitromina | DrugCentral |
| mydriacyl | DrugCentral |
| Mydriacyl (TN) | KEGG COMPOUND |
| NSC-757372 | ChEMBL |
| RO-1-7683 | ChEMBL |
| Brand Names | Source |
|---|---|
| Mydriafair | ChEMBL |
| Nods | ChEMBL |
| Tropicacyl | ChEMBL |
| Tropicamide component of mydcombi | ChEMBL |
| Tropicamide component of paremyd | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2774 | DrugCentral |
| D00397 | KEGG DRUG |
| HMDB0014947 | HMDB |
| LSM-1814 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:1508-75-4 | KEGG COMPOUND |
| CAS:1508-75-4 | DrugCentral |
| Citations |
|---|