EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N2O2 |
| Net Charge | 0 |
| Average Mass | 284.359 |
| Monoisotopic Mass | 284.15248 |
| SMILES | CCN(Cc1ccncc1)C(=O)C(CO)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O2/c1-2-19(12-14-8-10-18-11-9-14)17(21)16(13-20)15-6-4-3-5-7-15/h3-11,16,20H,2,12-13H2,1H3 |
| InChIKey | BGDKAVGWHJFAGW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tropicamide (CHEBI:9757) has role antihypertensive agent (CHEBI:35674) |
| Tropicamide (CHEBI:9757) has role antiparkinson drug (CHEBI:48407) |
| Tropicamide (CHEBI:9757) has role ophthalmology drug (CHEBI:66981) |
| Tropicamide (CHEBI:9757) is a acetamides (CHEBI:22160) |
| INN | Source |
|---|---|
| tropicamida | WHO MedNet |
| Synonyms | Source |
|---|---|
| bistropamide | DrugCentral |
| epitromina | DrugCentral |
| mydriacyl | DrugCentral |
| Mydriacyl (TN) | KEGG COMPOUND |
| NSC-757372 | ChEMBL |
| RO-1-7683 | ChEMBL |
| Brand Names | Source |
|---|---|
| Mydriafair | ChEMBL |
| Nods | ChEMBL |
| Tropicacyl | ChEMBL |
| Tropicamide component of mydcombi | ChEMBL |
| Tropicamide component of paremyd | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2774 | DrugCentral |
| D00397 | KEGG DRUG |
| HMDB0014947 | HMDB |
| LSM-1814 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:1508-75-4 | KEGG COMPOUND |
| CAS:1508-75-4 | DrugCentral |
| Citations |
|---|