EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9753 - troglitazone
| Formula | C24H27NO5S |
| Net Charge | 0 |
| Average Mass | 441.549 |
| Monoisotopic Mass | 441.16099 |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(COc1ccc(CC3SC(=O)NC3=O)cc1)O2 |
| InChI | InChI=1S/C24H27NO5S/c1-13-14(2)21-18(15(3)20(13)26)9-10-24(4,30-21)12-29-17-7-5-16(6-8-17)11-19-22(27)25-23(28)31-19/h5-8,19,26H,9-12H2,1-4H3,(H,25,27,28) |
| InChIKey | GXPHKUHSUJUWKP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | EC 6.2.1.3 (long-chain-fatty-acid--CoA ligase) inhibitor An EC 6.2.1.* (acid-thiol ligase) inhibitor that interferes with the action of a long-chain-fatty-acid—CoA ligase (EC 6.2.1.3). ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. vasodilator agent A drug used to cause dilation of the blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. hypoglycemic agent A drug which lowers the blood glucose level. anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| troglitazone (CHEBI:9753) has role anticoagulant (CHEBI:50249) |
| troglitazone (CHEBI:9753) has role anticonvulsant (CHEBI:35623) |
| troglitazone (CHEBI:9753) has role antineoplastic agent (CHEBI:35610) |
| troglitazone (CHEBI:9753) has role antioxidant (CHEBI:22586) |
| troglitazone (CHEBI:9753) has role EC 6.2.1.3 (long-chain-fatty-acid—CoA ligase) inhibitor (CHEBI:83157) |
| troglitazone (CHEBI:9753) has role ferroptosis inhibitor (CHEBI:173084) |
| troglitazone (CHEBI:9753) has role hypoglycemic agent (CHEBI:35526) |
| troglitazone (CHEBI:9753) has role platelet aggregation inhibitor (CHEBI:50427) |
| troglitazone (CHEBI:9753) has role vasodilator agent (CHEBI:35620) |
| troglitazone (CHEBI:9753) is a chromanes (CHEBI:23230) |
| troglitazone (CHEBI:9753) is a thiazolidinone (CHEBI:48891) |
| IUPAC Name |
|---|
| 5-{4-[(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydro-2H-chromen-2-yl)methoxy]benzyl}-1,3-thiazolidine-2,4-dione |
| INNs | Source |
|---|---|
| troglitazona | ChEBI |
| troglitazone | ChEBI |
| troglitazonum | ChEBI |
| Synonyms | Source |
|---|---|
| 5-(4-(6-Hydroxy-2,5,7,8-tetramethylchroman-2-ylmethoxy)benzyl)thiazolidine-2,4-dione | ChemIDplus |
| (+-)-all-rac-5-(p-((6-Hydroxy-2,5,7,8-tetramethyl-2-chromanyl)methoxy)benzyl)-2,4-thiazolidinedione | ChemIDplus |
| Rezulin (TN) | KEGG DRUG |
| Romglizone | ChemIDplus |
| Troglitazone | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4338399 | Beilstein |
| CAS:97322-87-7 | KEGG DRUG |
| CAS:97322-87-7 | ChemIDplus |