EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O6 |
| Net Charge | 0 |
| Average Mass | 360.406 |
| Monoisotopic Mass | 360.15729 |
| SMILES | [H][C@@]12C[C@@H]3O[C@@]34[C@H](O)[C@@]3(C(C)C)O[C@@]3([H])[C@@H]3O[C@@]34[C@@]1(C)CCC1=C2COC1=O |
| InChI | InChI=1S/C20H24O6/c1-8(2)18-13(25-18)14-20(26-14)17(3)5-4-9-10(7-23-15(9)21)11(17)6-12-19(20,24-12)16(18)22/h8,11-14,16,22H,4-7H2,1-3H3/t11-,12-,13-,14-,16+,17-,18-,19+,20+/m0/s1 |
| InChIKey | DFBIRQPKNDILPW-CIVMWXNOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antispermatogenic agent An agent that destroy spermatozoa in the male genitalia and block spermatogenesis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Triptolide (CHEBI:9747) has role antispermatogenic agent (CHEBI:145047) |
| Triptolide (CHEBI:9747) has role plant metabolite (CHEBI:76924) |
| Triptolide (CHEBI:9747) is a diterpenoid (CHEBI:23849) |
| Triptolide (CHEBI:9747) is a epoxide (CHEBI:32955) |
| Triptolide (CHEBI:9747) is a organic heteroheptacyclic compound (CHEBI:52157) |
| Triptolide (CHEBI:9747) is a γ-lactam (CHEBI:74222) |
| Synonym | Source |
|---|---|
| Triptolide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00003494 | KNApSAcK |
| C09204 | KEGG COMPOUND |
| LSM-5518 | LINCS |
| Triptolide | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:38748-32-2 | KEGG COMPOUND |