EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N4O4 |
| Net Charge | 0 |
| Average Mass | 450.539 |
| Monoisotopic Mass | 450.22671 |
| SMILES | O=C(NCC1CCCCC1)[C@@H]1[C@@H](CO)[C@@H]2Cn3c(cccc3=O)[C@H]1N2C(=O)c1cccnc1 |
| InChI | InChI=1S/C25H30N4O4/c30-15-18-20-14-28-19(9-4-10-21(28)31)23(29(20)25(33)17-8-5-11-26-13-17)22(18)24(32)27-12-16-6-2-1-3-7-16/h4-5,8-11,13,16,18,20,22-23,30H,1-3,6-7,12,14-15H2,(H,27,32)/t18-,20-,22+,23+/m0/s1 |
| InChIKey | CJMOIVLGTXOFHT-NEKRIBJYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-8759 (CHEBI:97380) is a aromatic carboxylic acid (CHEBI:33859) |
| LSM-8759 (CHEBI:97380) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Manual Xrefs | Databases |
|---|---|
| LSM-8759 | LINCS |