EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9737 - trimetrexate
| Formula | C19H23N5O3 |
| Net Charge | 0 |
| Average Mass | 369.425 |
| Monoisotopic Mass | 369.18009 |
| SMILES | COc1cc(NCc2ccc3nc(N)nc(N)c3c2C)cc(OC)c1OC |
| InChI | InChI=1S/C19H23N5O3/c1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24) |
| InChIKey | NOYPYLRCIDNJJB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimetrexate (CHEBI:9737) has role antifungal drug (CHEBI:86327) |
| trimetrexate (CHEBI:9737) is a quinazolines (CHEBI:38530) |
| Synonyms | Source |
|---|---|
| Trimetrexate | KEGG COMPOUND |
| TRIMETREXATE | PDBeChem |
| 2,4-diamino-5-methyl-6-{[(3,4,5-trimethoxyphenyl)amino]methyl}quinazolin-1-ium | PDBeChem |
| CI-898 | DrugCentral |
| JB-11 | DrugCentral |
| trimetrexate hydrate | DrugCentral |