EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N2OS |
| Net Charge | +1 |
| Average Mass | 365.522 |
| Monoisotopic Mass | 365.16821 |
| SMILES | O=C1N(Cc2ccccc2)C2C[S+]3CCCC3C2N1Cc1ccccc1 |
| InChI | InChI=1S/C22H25N2OS/c25-22-23(14-17-8-3-1-4-9-17)19-16-26-13-7-12-20(26)21(19)24(22)15-18-10-5-2-6-11-18/h1-6,8-11,19-21H,7,12-16H2/q+1 |
| InChIKey | CHQOEHPMXSHGCL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. anaesthesia adjuvant Any substance that possesses little anaesthetic effect by itself, but which enhances or potentiates the anaesthetic action of other drugs when given at the same time. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimethaphan (CHEBI:9728) has role anaesthesia adjuvant (CHEBI:60807) |
| trimethaphan (CHEBI:9728) has role antihypertensive agent (CHEBI:35674) |
| trimethaphan (CHEBI:9728) has role nicotinic antagonist (CHEBI:48878) |
| trimethaphan (CHEBI:9728) has role vasodilator agent (CHEBI:35620) |
| trimethaphan (CHEBI:9728) is a sulfonium compound (CHEBI:26830) |
| Incoming Relation(s) |
| trimethaphan camsylate (CHEBI:9729) has part trimethaphan (CHEBI:9728) |
| IUPAC Name |
|---|
| 1,3-dibenzyl-2-oxodecahydrothieno[1',2':1,2]thieno[3,4-d]imidazol-5-ium |
| Synonyms | Source |
|---|---|
| Trimetaphan | ChemIDplus |
| Trimetaphanum | ChemIDplus |
| Trimethaphan | KEGG COMPOUND |