EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9NO3 |
| Net Charge | 0 |
| Average Mass | 143.142 |
| Monoisotopic Mass | 143.05824 |
| SMILES | CN1C(=O)OC(C)(C)C1=O |
| InChI | InChI=1S/C6H9NO3/c1-6(2)4(8)7(3)5(9)10-6/h1-3H3 |
| InChIKey | IRYJRGCIQBGHIV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimethadione (CHEBI:9727) has role anticonvulsant (CHEBI:35623) |
| trimethadione (CHEBI:9727) has role geroprotector (CHEBI:176497) |
| trimethadione (CHEBI:9727) is a oxazolidinone (CHEBI:55374) |
| IUPAC Name |
|---|
| 3,5,5-trimethyl-1,3-oxazolidine-2,4-dione |
| INNs | Source |
|---|---|
| trimetadiona | WHO MedNet |
| trimethadione | WHO MedNet |
| triméthadione | WHO MedNet |
| trimethadionum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 3,5,5-trimethyl-2,4-oxazolidinedione | ChemIDplus |
| trimetadione | DrugCentral |
| Brand Names | Source |
|---|---|
| Absentol | ChemIDplus |
| Absetil | ChemIDplus |
| Convenixa | ChemIDplus |
| Edion | ChemIDplus |
| Epidione | ChemIDplus |
| Epixal | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2751 | DrugCentral |
| D00392 | KEGG DRUG |
| DB00347 | DrugBank |
| HMDB0014491 | HMDB |
| LSM-5345 | LINCS |
| Trimethadione | Wikipedia |
| Citations |
|---|