EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9715 - triforine
| Formula | C10H14Cl6N4O2 |
| Net Charge | 0 |
| Average Mass | 434.966 |
| Monoisotopic Mass | 431.92479 |
| SMILES | [H]C(=O)NC(N1CCN(C(NC([H])=O)C(Cl)(Cl)Cl)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H14Cl6N4O2/c11-9(12,13)7(17-5-21)19-1-2-20(4-3-19)8(18-6-22)10(14,15)16/h5-8H,1-4H2,(H,17,21)(H,18,22) |
| InChIKey | RROQIUMZODEXOR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of EC 1.14.13.70 (sterol 14α-demethylase). allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triforine (CHEBI:9715) has role allergen (CHEBI:50904) |
| triforine (CHEBI:9715) has role antifungal agrochemical (CHEBI:86328) |
| triforine (CHEBI:9715) has role EC 1.14.13.70 (sterol 14α-demethylase) inhibitor (CHEBI:77884) |
| triforine (CHEBI:9715) is a N-alkylpiperazine (CHEBI:46845) |
| triforine (CHEBI:9715) is a amide fungicide (CHEBI:60600) |
| triforine (CHEBI:9715) is a formamides (CHEBI:24079) |
| triforine (CHEBI:9715) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| N,N'-[piperazine-1,4-diylbis(2,2,2-trichloroethane-1,1-diyl)]diformamide |
| Synonyms | Source |
|---|---|
| 1,4-Bis(1-formamido-2,2,2-trichloroethyl)piperazine | ChemIDplus |
| Biformylchlorazin | ChemIDplus |
| N,N'-(1,4-Piperazinediylbis(2,2,2-trichloroethylidene))bisformamide | ChemIDplus |
| N,N'-(Piperazine-1,4-diylbis((trichloromethyl)methylene))diformamide | ChemIDplus |
| 1,4-Bis(2,2,2-trichloro-1-formamidoethyl)piperazine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Funginex | ChemIDplus |
| Funginex | ChemIDplus |
| Citations |
|---|