EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9701 - tridihexethyl
| Formula | C21H36NO |
| Net Charge | +1 |
| Average Mass | 318.525 |
| Monoisotopic Mass | 318.27914 |
| SMILES | CC[N+](CC)(CC)CCC(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H36NO/c1-4-22(5-2,6-3)18-17-21(23,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7,9-10,13-14,20,23H,4-6,8,11-12,15-18H2,1-3H3/q+1 |
| InChIKey | NPRHVSBSZMAEIN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tridihexethyl (CHEBI:9701) has role anti-ulcer drug (CHEBI:49201) |
| tridihexethyl (CHEBI:9701) has role antispasmodic drug (CHEBI:53784) |
| tridihexethyl (CHEBI:9701) has role muscarinic antagonist (CHEBI:48876) |
| tridihexethyl (CHEBI:9701) is a quaternary ammonium ion (CHEBI:35267) |
| tridihexethyl (CHEBI:9701) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| tridihexethyl bromide (CHEBI:9702) has part tridihexethyl (CHEBI:9701) |
| tridihexethyl chloride (CHEBI:9703) has part tridihexethyl (CHEBI:9701) |
| tridihexethyl iodide (CHEBI:9704) has part tridihexethyl (CHEBI:9701) |
| IUPAC Name |
|---|
| 3-cyclohexyl-N,N,N-triethyl-3-hydroxy-3-phenylpropan-1-aminium |
| Synonyms | Source |
|---|---|
| Propethonum | ChemIDplus |
| Tridihexethyl | KEGG COMPOUND |