EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9701 - tridihexethyl
| Formula | C21H36NO |
| Net Charge | +1 |
| Average Mass | 318.525 |
| Monoisotopic Mass | 318.27914 |
| SMILES | CC[N+](CC)(CC)CCC(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H36NO/c1-4-22(5-2,6-3)18-17-21(23,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7,9-10,13-14,20,23H,4-6,8,11-12,15-18H2,1-3H3/q+1 |
| InChIKey | NPRHVSBSZMAEIN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tridihexethyl (CHEBI:9701) has role anti-ulcer drug (CHEBI:49201) |
| tridihexethyl (CHEBI:9701) has role antispasmodic drug (CHEBI:53784) |
| tridihexethyl (CHEBI:9701) has role muscarinic antagonist (CHEBI:48876) |
| tridihexethyl (CHEBI:9701) is a quaternary ammonium ion (CHEBI:35267) |
| tridihexethyl (CHEBI:9701) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| tridihexethyl bromide (CHEBI:9702) has part tridihexethyl (CHEBI:9701) |
| tridihexethyl chloride (CHEBI:9703) has part tridihexethyl (CHEBI:9701) |
| tridihexethyl iodide (CHEBI:9704) has part tridihexethyl (CHEBI:9701) |
| IUPAC Name |
|---|
| 3-cyclohexyl-N,N,N-triethyl-3-hydroxy-3-phenylpropan-1-aminium |
| Synonyms | Source |
|---|---|
| Tridihexethyl | KEGG COMPOUND |
| Propethonum | ChemIDplus |