EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O3 |
| Net Charge | 0 |
| Average Mass | 280.323 |
| Monoisotopic Mass | 280.10994 |
| SMILES | COc1ccc(CCc2cc(=O)c3ccccc3o2)cc1 |
| InChI | InChI=1S/C18H16O3/c1-20-14-9-6-13(7-10-14)8-11-15-12-17(19)16-4-2-3-5-18(16)21-15/h2-7,9-10,12H,8,11H2,1H3 |
| InChIKey | ZQBJPQZBIGVILA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aquilaria sinensis (ncbitaxon:210372) | wood (BTO:0005516) | PubMed (27223280) | Found in agarwood. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(2-(4-methoxyphenyl)ethyl)chromone (CHEBI:969) has functional parent chromone (CHEBI:72013) |
| 2-(2-(4-methoxyphenyl)ethyl)chromone (CHEBI:969) has role plant metabolite (CHEBI:76924) |
| 2-(2-(4-methoxyphenyl)ethyl)chromone (CHEBI:969) is a chromones (CHEBI:23238) |
| 2-(2-(4-methoxyphenyl)ethyl)chromone (CHEBI:969) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| 2-[2-(4-methoxyphenyl)ethyl]-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-[2-(4-methoxyphenyl)ethyl]-4H-1-benzopyran-4-one | IUPAC |
| 2-[2-(4-methoxyphenyl)ethyl]chromen-4-one | ChEBI |
| 2-(4-methoxyphenethyl)chromone | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:92911-82-5 | ChemIDplus |
| CAS:92911-82-5 | NIST Chemistry WebBook |
| Citations |
|---|