EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24O4 |
| Net Charge | 0 |
| Average Mass | 292.375 |
| Monoisotopic Mass | 292.16746 |
| SMILES | [H][C@@]12C=C(C)CC[C@]1(C)[C@@]1(C)[C@H](OC(C)=O)C[C@@]([H])(O2)[C@]12CO2 |
| InChI | InChI=1S/C17H24O4/c1-10-5-6-15(3)12(7-10)21-14-8-13(20-11(2)18)16(15,4)17(14)9-19-17/h7,12-14H,5-6,8-9H2,1-4H3/t12-,13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | HNEGCRMUYSKRRR-NWHWRWDZSA-N |
| Roles Classification |
|---|
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trichodermin (CHEBI:9688) has role antifungal agent (CHEBI:35718) |
| trichodermin (CHEBI:9688) has role antineoplastic agent (CHEBI:35610) |
| trichodermin (CHEBI:9688) has role protein synthesis inhibitor (CHEBI:48001) |
| trichodermin (CHEBI:9688) is a epoxide (CHEBI:32955) |
| trichodermin (CHEBI:9688) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| (4β,12R)-12,13-epoxytrichothec-9-en-4-yl acetate |
| Synonym | Source |
|---|---|
| 12,13-Epoxytrichothec-9-en-4-ol acetate | ChemIDplus |
| Citations |
|---|