EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8Cl3N3O4S2 |
| Net Charge | 0 |
| Average Mass | 380.662 |
| Monoisotopic Mass | 378.90218 |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)NC(C(Cl)Cl)NS2(=O)=O |
| InChI | InChI=1S/C8H8Cl3N3O4S2/c9-3-1-4-6(2-5(3)19(12,15)16)20(17,18)14-8(13-4)7(10)11/h1-2,7-8,13-14H,(H2,12,15,16) |
| InChIKey | LMJSLTNSBFUCMU-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. diuretic An agent that promotes the excretion of urine through its effects on kidney function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trichlormethiazide (CHEBI:9683) has role antihypertensive agent (CHEBI:35674) |
| trichlormethiazide (CHEBI:9683) has role diuretic (CHEBI:35498) |
| trichlormethiazide (CHEBI:9683) is a benzothiadiazine (CHEBI:50265) |
| trichlormethiazide (CHEBI:9683) is a sulfonamide antibiotic (CHEBI:87228) |
| IUPAC Name |
|---|
| 6-chloro-3-(dichloromethyl)-3,4-dihydro-2H-1,2,4-benzothiadiazine-7-sulfonamide 1,1-dioxide |
| INNs | Source |
|---|---|
| trichlormethiazide | ChemIDplus |
| trichlormethiazidum | ChemIDplus |
| triclormetiazida | ChemIDplus |
| Synonym | Source |
|---|---|
| hydrotrichlorothiazide | ChemIDplus |
| Citations |
|---|