EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4Cl3NO3 |
| Net Charge | 0 |
| Average Mass | 256.472 |
| Monoisotopic Mass | 254.92568 |
| SMILES | O=C(O)COc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C7H4Cl3NO3/c8-3-1-4(9)7(11-6(3)10)14-2-5(12)13/h1H,2H2,(H,12,13) |
| InChIKey | REEQLXCGVXDJSQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | herbicide A substance used to destroy plant pests. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trichlopyr (CHEBI:9682) has role agrochemical (CHEBI:33286) |
| trichlopyr (CHEBI:9682) has role environmental contaminant (CHEBI:78298) |
| trichlopyr (CHEBI:9682) has role herbicide (CHEBI:24527) |
| trichlopyr (CHEBI:9682) has role xenobiotic (CHEBI:35703) |
| trichlopyr (CHEBI:9682) is a aromatic ether (CHEBI:35618) |
| trichlopyr (CHEBI:9682) is a chloropyridine (CHEBI:39173) |
| trichlopyr (CHEBI:9682) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| [(3,5,6-trichloropyridin-2-yl)oxy]acetic acid |
| Synonym | Source |
|---|---|
| Triclopyr | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:225301 | Reaxys |
| CAS:55335-06-3 | KEGG COMPOUND |
| CAS:55335-06-3 | ChemIDplus |
| Citations |
|---|