EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16ClN5O5S |
| Net Charge | 0 |
| Average Mass | 401.832 |
| Monoisotopic Mass | 401.05607 |
| SMILES | COc1nc(C)nc(NC(=O)NS(=O)(=O)c2ccccc2OCCCl)n1 |
| InChI | InChI=1S/C14H16ClN5O5S/c1-9-16-12(19-14(17-9)24-2)18-13(21)20-26(22,23)11-6-4-3-5-10(11)25-8-7-15/h3-6H,7-8H2,1-2H3,(H2,16,17,18,19,20,21) |
| InChIKey | XOPFESVZMSQIKC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triasulfuron (CHEBI:9673) has role agrochemical (CHEBI:33286) |
| triasulfuron (CHEBI:9673) has role herbicide (CHEBI:24527) |
| triasulfuron (CHEBI:9673) is a N-sulfonylurea (CHEBI:76983) |
| triasulfuron (CHEBI:9673) is a methoxy-1,3,5-triazine (CHEBI:38177) |
| triasulfuron (CHEBI:9673) is a organochlorine compound (CHEBI:36683) |
| IUPAC Name |
|---|
| 2-(2-chloroethoxy)-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]benzenesulfonamide |
| Synonyms | Source |
|---|---|
| 1-[2-(2-chloroethoxy)phenylsulfonyl]-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea | Alan Wood's Pesticides |
| 2-(2-chloroethoxy)-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]benzenesulfonamide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| 651 | PPDB |
| C10961 | KEGG COMPOUND |
| EP44808 | Patent |
| triasulfuron | Alan Wood's Pesticides |
| US4514212 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7151883 | Reaxys |
| CAS:82097-50-5 | ChemIDplus |
| CAS:82097-50-5 | KEGG COMPOUND |
| Citations |
|---|