EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11N7 |
| Net Charge | 0 |
| Average Mass | 253.269 |
| Monoisotopic Mass | 253.10759 |
| SMILES | Nc1nc(N)c2nc(-c3ccccc3)c(N)nc2n1 |
| InChI | InChI=1S/C12H11N7/c13-9-7(6-4-2-1-3-5-6)16-8-10(14)18-12(15)19-11(8)17-9/h1-5H,(H6,13,14,15,17,18,19) |
| InChIKey | FNYLWPVRPXGIIP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. |
| Application: | diuretic An agent that promotes the excretion of urine through its effects on kidney function. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triamterene (CHEBI:9671) has role diuretic (CHEBI:35498) |
| triamterene (CHEBI:9671) has role sodium channel blocker (CHEBI:38633) |
| triamterene (CHEBI:9671) is a pteridines (CHEBI:26373) |
| IUPAC Name |
|---|
| 6-phenylpteridine-2,4,7-triamine |
| INNs | Source |
|---|---|
| triamterena | ChemIDplus |
| triamterene | ChemIDplus |
| triamterenum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2728 | DrugCentral |
| D00386 | KEGG DRUG |
| LSM-4060 | LINCS |
| Triamterene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:396-01-0 | ChemIDplus |
| Citations |
|---|