EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11N7 |
| Net Charge | 0 |
| Average Mass | 253.269 |
| Monoisotopic Mass | 253.10759 |
| SMILES | Nc1nc(N)c2nc(-c3ccccc3)c(N)nc2n1 |
| InChI | InChI=1S/C12H11N7/c13-9-7(6-4-2-1-3-5-6)16-8-10(14)18-12(15)19-11(8)17-9/h1-5H,(H6,13,14,15,17,18,19) |
| InChIKey | FNYLWPVRPXGIIP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. hypoglycemic agent A drug which lowers the blood glucose level. diuretic An agent that promotes the excretion of urine through its effects on kidney function. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triamterene (CHEBI:9671) has role antiatherosclerotic agent (CHEBI:145947) |
| triamterene (CHEBI:9671) has role antihypertensive agent (CHEBI:35674) |
| triamterene (CHEBI:9671) has role cardiovascular drug (CHEBI:35554) |
| triamterene (CHEBI:9671) has role diuretic (CHEBI:35498) |
| triamterene (CHEBI:9671) has role hepatoprotective agent (CHEBI:62868) |
| triamterene (CHEBI:9671) has role hypoglycemic agent (CHEBI:35526) |
| triamterene (CHEBI:9671) has role sodium channel blocker (CHEBI:38633) |
| triamterene (CHEBI:9671) is a pteridines (CHEBI:26373) |
| IUPAC Name |
|---|
| 6-phenylpteridine-2,4,7-triamine |
| INNs | Source |
|---|---|
| triamterena | ChemIDplus |
| triamterene | ChemIDplus |
| triamtereno | WHO MedNet |
| triamterenum | ChemIDplus |
| Synonyms | Source |
|---|---|
| NSC-639359 | ChEMBL |
| NSC-77625 | ChEMBL |
| SK-8542 | ChEMBL |
| SK&F 8542 | ChEMBL |
| SK&F-8542 | ChEMBL |
| Brand Names | Source |
|---|---|
| Dyrenium | ChEMBL |
| Dytac | ChEMBL |
| Triamterene component of dyazide | ChEMBL |
| Triamterene component of maxzide | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2728 | DrugCentral |
| D00386 | KEGG DRUG |
| LSM-4060 | LINCS |
| Triamterene | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:396-01-0 | ChemIDplus |
| Citations |
|---|