EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H40N2O6S |
| Net Charge | 0 |
| Average Mass | 568.736 |
| Monoisotopic Mass | 568.26071 |
| SMILES | C[C@@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(C#CCC3CCCC3)cc2O[C@H]1CN(C)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C31H40N2O6S/c1-22-18-33(23(2)21-34)40(37,38)30-15-14-25(11-6-10-24-8-4-5-9-24)17-28(30)39-29(22)20-32(3)19-26-12-7-13-27(16-26)31(35)36/h7,12-17,22-24,29,34H,4-5,8-10,18-21H2,1-3H3,(H,35,36)/t22-,23+,29+/m1/s1 |
| InChIKey | DKZVPIDPIJUHTD-AFKLWXAFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[[[(4R,5R)-8-(3-cyclopentylprop-1-ynyl)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1$l^{6},2-benzoxathiazocin-5-yl]methyl-methylamino]methyl]benzoic acid (CHEBI:96540) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-7919 | LINCS |