EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C9H11N.H2O4S |
| Net Charge | 0 |
| Average Mass | 364.467 |
| Monoisotopic Mass | 364.14568 |
| SMILES | N[C@@H]1CC1c1ccccc1.N[C@@H]1CC1c1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/2C9H11N.H2O4S/c2*10-9-6-8(9)7-4-2-1-3-5-7;1-5(2,3)4/h2*1-5,8-9H,6,10H2;(H2,1,2,3,4)/t2*8?,9-;/m11./s1 |
| InChIKey | BKPRVQDIOGQWTG-VYIKEJMZSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tranylcypromine sulfate (CHEBI:9653) has role antidepressant (CHEBI:35469) |
| tranylcypromine sulfate (CHEBI:9653) is a alkylammonium sulfate (CHEBI:38015) |
| Synonyms | Source |
|---|---|
| NSC-757342 | ChEMBL |
| Parnate | KEGG COMPOUND |
| Tranylcypromine sulfate | KEGG COMPOUND |
| Tranylcypromine sulphate | ChEMBL |
| Brand Name | Source |
|---|---|
| Parstelin | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00826 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:13492-01-8 | KEGG COMPOUND |
| Citations |
|---|