EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33N3O5 |
| Net Charge | 0 |
| Average Mass | 467.566 |
| Monoisotopic Mass | 467.24202 |
| SMILES | CC=Cc1cnc2c(c1)C(=O)N([C@H](C)CO)C[C@H](C)[C@@H](CN(C)Cc1cccc(C(=O)O)c1)O2 |
| InChI | InChI=1S/C26H33N3O5/c1-5-7-19-11-22-24(27-12-19)34-23(17(2)13-29(25(22)31)18(3)16-30)15-28(4)14-20-8-6-9-21(10-20)26(32)33/h5-12,17-18,23,30H,13-16H2,1-4H3,(H,32,33)/t17-,18+,23+/m0/s1 |
| InChIKey | FNIHZEFWPVWWQI-YZZKKUAISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LSM-7814 (CHEBI:96435) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-7814 | LINCS |