EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28ClNO.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 598.092 |
| Monoisotopic Mass | 597.21294 |
| SMILES | CN(C)CCOc1ccc(/C(=C(/CCCl)c2ccccc2)c2ccccc2)cc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H28ClNO.C6H8O7/c1-28(2)19-20-29-24-15-13-23(14-16-24)26(22-11-7-4-8-12-22)25(17-18-27)21-9-5-3-6-10-21;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-16H,17-20H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b26-25-; |
| InChIKey | IWEQQRMGNVVKQW-OQKDUQJOSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Toremifene citrate (CHEBI:9636) has role anticoronaviral agent (CHEBI:149553) |
| Toremifene citrate (CHEBI:9636) is a stilbenoid (CHEBI:26776) |
| Synonyms | Source |
|---|---|
| Toremifene citrate | KEGG COMPOUND |
| Fareston (TN) | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| D00967 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:89778-27-8 | KEGG COMPOUND |