EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9619 - tolmetin sodium
| Formula | C15H14NO3.Na |
| Net Charge | 0 |
| Average Mass | 279.271 |
| Monoisotopic Mass | 279.08714 |
| SMILES | Cc1ccc(C(=O)c2ccc(CC(=O)[O-])n2C)cc1.[Na+] |
| InChI | InChI=1S/C15H15NO3.Na/c1-10-3-5-11(6-4-10)15(19)13-8-7-12(16(13)2)9-14(17)18;/h3-8H,9H2,1-2H3,(H,17,18);/q;+1/p-1 |
| InChIKey | QGUALMNFRILWRA-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tolmetin sodium (CHEBI:9619) has part tolmetin(1−) (CHEBI:72213) |
| tolmetin sodium (CHEBI:9619) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| tolmetin sodium (CHEBI:9619) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| tolmetin sodium (CHEBI:9619) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| tolmetin sodium dihydrate (CHEBI:72014) has part tolmetin sodium (CHEBI:9619) |
| IUPAC Name |
|---|
| sodium [1-methyl-5-(4-methylbenzoyl)-1H-pyrrol-2-yl]acetate |
| Synonyms | Source |
|---|---|
| Sodium 1-methyl-5-(4-methylbenzoyl)-1H-pyrrole-2-acetate | ChemIDplus |
| Tolmetin sodium anhydrous | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C02328 | KEGG COMPOUND |
| DB00500 | DrugBank |
| WO2004005309 | Patent |
| US4349563 | Patent |
| WO2009072139 | Patent |
| Tolmetin_sodium | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4626313 | Reaxys |
| CAS:64490-92-2 | KEGG COMPOUND |
| CAS:35711-34-3 | ChemIDplus |
| Citations |
|---|