EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O |
| Net Charge | 0 |
| Average Mass | 192.262 |
| Monoisotopic Mass | 192.12626 |
| SMILES | Cc1cccc(C)c1NC(=O)C(C)N |
| InChI | InChI=1S/C11H16N2O/c1-7-5-4-6-8(2)10(7)13-11(14)9(3)12/h4-6,9H,12H2,1-3H3,(H,13,14) |
| InChIKey | BUJAGSGYPOAWEI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. |
| Applications: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tocainide (CHEBI:9611) has role anti-arrhythmia drug (CHEBI:38070) |
| tocainide (CHEBI:9611) has role local anaesthetic (CHEBI:36333) |
| tocainide (CHEBI:9611) has role sodium channel blocker (CHEBI:38633) |
| tocainide (CHEBI:9611) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| N-(2,6-dimethylphenyl)alaninamide |
| INNs | Source |
|---|---|
| tocainida | ChemIDplus |
| tocainide | ChemIDplus |
| tocainidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-Amino-2',6'-propionoxylidide | ChemIDplus |
| 2-amino-N-(2,6-dimethylphenyl)propanamide | ChEBI |
| 2-Amino-N-(2,6-dimethylphenyl)propionamid | ChemIDplus |
| Alanyl-2,6-xylidide | ChemIDplus |
| Citations |
|---|