EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36N2O6S |
| Net Charge | 0 |
| Average Mass | 552.693 |
| Monoisotopic Mass | 552.22941 |
| SMILES | Cc1ccccc1-c1ccc2c(c1)O[C@H](CN(C)Cc1ccc(C(=O)O)cc1)[C@H](C)CN([C@@H](C)CO)S2(=O)=O |
| InChI | InChI=1S/C30H36N2O6S/c1-20-7-5-6-8-26(20)25-13-14-29-27(15-25)38-28(21(2)16-32(22(3)19-33)39(29,36)37)18-31(4)17-23-9-11-24(12-10-23)30(34)35/h5-15,21-22,28,33H,16-19H2,1-4H3,(H,34,35)/t21-,22+,28-/m1/s1 |
| InChIKey | VHCZRFPKNWPULV-RZIGYZOXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[[[(4R,5S)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-8-(2-methylphenyl)-1,1-dioxo-4,5-dihydro-3H-6,1$l^{6},2-benzoxathiazocin-5-yl]methyl-methylamino]methyl]benzoic acid (CHEBI:96105) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-7484 | LINCS |