EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8ClN5S.HCl |
| Net Charge | 0 |
| Average Mass | 290.179 |
| Monoisotopic Mass | 288.99557 |
| SMILES | Cl.Clc1ccc2nsnc2c1NC1=NCCN1 |
| InChI | InChI=1S/C9H8ClN5S.ClH/c10-5-1-2-6-8(15-16-14-6)7(5)13-9-11-3-4-12-9;/h1-2H,3-4H2,(H2,11,12,13);1H |
| InChIKey | ZWUKMNZJRDGCTQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tizanidine hydrochloride (CHEBI:9609) has role neuroprotective agent (CHEBI:63726) |
| Tizanidine hydrochloride (CHEBI:9609) is a benzothiadiazole (CHEBI:48864) |
| Synonyms | Source |
|---|---|
| AN-021 | ChEMBL |
| DS-103-282 | ChEMBL |
| Tizanidine (as hydrochloride) | ChEMBL |
| Tizanidine hydrochloride | KEGG COMPOUND |
| Brand Names | Source |
|---|---|
| Sirdalud | ChEMBL |
| Sirdalud mr | ChEMBL |
| Zanaflex | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D00776 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:64461-82-1 | KEGG COMPOUND |