EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H33FN2O6S |
| Net Charge | 0 |
| Average Mass | 556.656 |
| Monoisotopic Mass | 556.20434 |
| SMILES | C[C@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(-c3ccc(F)cc3)cc2O[C@@H]1CN(C)Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C29H33FN2O6S/c1-19-15-32(20(2)18-33)39(36,37)28-13-10-22(21-8-11-24(30)12-9-21)14-26(28)38-27(19)17-31(3)16-23-6-4-5-7-25(23)29(34)35/h4-14,19-20,27,33H,15-18H2,1-3H3,(H,34,35)/t19-,20-,27+/m0/s1 |
| InChIKey | KSASPYMRGHUFQD-OWOAZTCBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[[[(4S,5S)-8-(4-fluorophenyl)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1$l^{6},2-benzoxathiazocin-5-yl]methyl-methylamino]methyl]benzoic acid (CHEBI:96083) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-7462 | LINCS |