EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H36N2O5S |
| Net Charge | 0 |
| Average Mass | 440.606 |
| Monoisotopic Mass | 440.23449 |
| SMILES | CCCCS(=O)(=O)N[C@@H](Cc1ccc(OCCCCC2CCNCC2)cc1)C(=O)O |
| InChI | InChI=1S/C22H36N2O5S/c1-2-3-16-30(27,28)24-21(22(25)26)17-19-7-9-20(10-8-19)29-15-5-4-6-18-11-13-23-14-12-18/h7-10,18,21,23-24H,2-6,11-17H2,1H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | COKMIXFXJJXBQG-NRFANRHFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | platelet glycoprotein-IIb/IIIa receptor antagonist Antagonist of platelet surface glycoprotein-IIb/IIIa which has a key role in hemostasis and thrombosis such as platelet adhesion and aggregation. |
| Applications: | anticoagulant An agent that prevents blood clotting. platelet glycoprotein-IIb/IIIa receptor antagonist Antagonist of platelet surface glycoprotein-IIb/IIIa which has a key role in hemostasis and thrombosis such as platelet adhesion and aggregation. fibrin modulating drug A drug that affects the function of fibrin in blood coagulation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tirofiban (CHEBI:9605) has role anticoagulant (CHEBI:50249) |
| tirofiban (CHEBI:9605) has role fibrin modulating drug (CHEBI:48676) |
| tirofiban (CHEBI:9605) has role platelet glycoprotein-IIb/IIIa receptor antagonist (CHEBI:50433) |
| tirofiban (CHEBI:9605) is a L-tyrosine derivative (CHEBI:27177) |
| tirofiban (CHEBI:9605) is a piperidines (CHEBI:26151) |
| tirofiban (CHEBI:9605) is a sulfonamide (CHEBI:35358) |
| Incoming Relation(s) |
| tirofiban hydrochloride (CHEBI:9606) has part tirofiban (CHEBI:9605) |
| IUPAC Name |
|---|
| N-(butylsulfonyl)-O-(4-piperidin-4-ylbutyl)-L-tyrosine |
| INNs | Source |
|---|---|
| tirofiban | ChEBI |
| tirofibán | ChEBI |
| tirofibanum | ChEBI |
| Synonyms | Source |
|---|---|
| (2S)-2-(butylsulfonylamino)-3-[4-(4-piperidin-4-ylbutoxy)phenyl]propanoic acid | IUPAC |
| N-(Butylsulfonyl)-O-(4-(4-piperidyl)butyl)-L-tyrosine | ChemIDplus |
| Tirofiban | KEGG COMPOUND |