EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H38O8 |
| Net Charge | 0 |
| Average Mass | 598.692 |
| Monoisotopic Mass | 598.25667 |
| SMILES | [H][C@@]12C=C(COC(=O)Cc3ccc(O)cc3)C[C@]3(O)C(=O)C(C)=C[C@@]3([H])[C@]13O[C@]1(Cc4ccccc4)O[C@@]2([H])[C@](C(=C)C)(C[C@H]3C)O1 |
| InChI | InChI=1S/C36H38O8/c1-21(2)34-17-23(4)36-28(32(34)42-35(43-34,44-36)19-25-8-6-5-7-9-25)15-26(18-33(40)29(36)14-22(3)31(33)39)20-41-30(38)16-24-10-12-27(37)13-11-24/h5-15,23,28-29,32,37,40H,1,16-20H2,2-4H3/t23-,28+,29-,32-,33-,34-,35-,36-/m1/s1 |
| InChIKey | WWZMXEIBZCEIFB-ACAXUWNGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Euphorbia poissonii (ncbitaxon:212962) | - | DOI (/10.1016/S0031-9422(00)89024-X) | Isolated from latex. |
| Roles Classification |
|---|
| Biological Roles: | TRPV1 agonist An agonist at the transient receptor potential vanilloid 1 (TRPV1). neurotoxin A poison that interferes with the functions of the nervous system. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tinyatoxin (CHEBI:9603) has role neurotoxin (CHEBI:50910) |
| tinyatoxin (CHEBI:9603) has role plant metabolite (CHEBI:76924) |
| tinyatoxin (CHEBI:9603) has role TRPV1 agonist (CHEBI:140535) |
| tinyatoxin (CHEBI:9603) is a carboxylic ester (CHEBI:33308) |
| tinyatoxin (CHEBI:9603) is a diterpenoid (CHEBI:23849) |
| tinyatoxin (CHEBI:9603) is a enone (CHEBI:51689) |
| tinyatoxin (CHEBI:9603) is a organic heteropentacyclic compound (CHEBI:38164) |
| tinyatoxin (CHEBI:9603) is a ortho ester (CHEBI:71989) |
| tinyatoxin (CHEBI:9603) is a phenols (CHEBI:33853) |
| tinyatoxin (CHEBI:9603) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| IUPAC Name |
|---|
| [(2S,3aR,3bS,6aR,9aR,9bR,10R,11aR)-2-benzyl-6a-hydroxy-8,10-dimethyl-7-oxo-11a-(prop-1-en-2-yl)-3a,6,6a,7,9a,10,11,11a-octahydro-3bH-2,9b-epoxyazuleno[4',5':5,6]benzo[1,2-d][1,3]dioxol-5-yl]methyl (4-hydroxyphenyl)acetate |
| Manual Xrefs | Databases |
|---|---|
| C00003492 | KNApSAcK |
| C09201 | KEGG COMPOUND |
| Tinyatoxin | Wikipedia |
| US2009209633 | Patent |
| WO2008011532 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:58821-95-7 | ChemIDplus |
| CAS:58821-95-7 | KEGG COMPOUND |
| Citations |
|---|