EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21NO2 |
| Net Charge | 0 |
| Average Mass | 223.316 |
| Monoisotopic Mass | 223.15723 |
| SMILES | C/C=C(\C)C(=O)OC1CC2CCC(C1)N2C |
| InChI | InChI=1S/C13H21NO2/c1-4-9(2)13(15)16-12-7-10-5-6-11(8-12)14(10)3/h4,10-12H,5-8H2,1-3H3/b9-4+ |
| InChIKey | UVHGSMZRSVGWDJ-RUDMXATFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tigloidine (CHEBI:9593) is a tropane alkaloid (CHEBI:37332) |
| Synonyms | Source |
|---|---|
| 3beta-Tigloyloxytropane | DrugCentral |
| tigloidin | DrugCentral |
| Tigloidine | KEGG COMPOUND |
| tigloyl pseudotropine | DrugCentral |
| tiglylpseudotropine | DrugCentral |
| tiglyssin | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 3606 | DrugCentral |
| C00002304 | KNApSAcK |
| C00025557 | KNApSAcK |
| C10868 | KEGG COMPOUND |
| HMDB0029875 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:495-83-0 | KEGG COMPOUND |