EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8Cl2O4S |
| Net Charge | 0 |
| Average Mass | 331.176 |
| Monoisotopic Mass | 329.95204 |
| SMILES | O=C(O)COc1ccc(C(=O)c2cccs2)c(Cl)c1Cl |
| InChI | InChI=1S/C13H8Cl2O4S/c14-11-7(13(18)9-2-1-5-20-9)3-4-8(12(11)15)19-6-10(16)17/h1-5H,6H2,(H,16,17) |
| InChIKey | AGHANLSBXUWXTB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. loop diuretic A diuretic that acts on the ascending loop of Henle in the kidney. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tienilic acid (CHEBI:9590) has role antihypertensive agent (CHEBI:35674) |
| tienilic acid (CHEBI:9590) has role hepatotoxic agent (CHEBI:50908) |
| tienilic acid (CHEBI:9590) has role loop diuretic (CHEBI:77608) |
| tienilic acid (CHEBI:9590) is a aromatic ether (CHEBI:35618) |
| tienilic acid (CHEBI:9590) is a aromatic ketone (CHEBI:76224) |
| tienilic acid (CHEBI:9590) is a dichlorobenzene (CHEBI:23697) |
| tienilic acid (CHEBI:9590) is a monocarboxylic acid (CHEBI:25384) |
| tienilic acid (CHEBI:9590) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| [2,3-dichloro-4-(2-thienylcarbonyl)phenoxy]acetic acid |
| INNs | Source |
|---|---|
| tienilic acid | KEGG DRUG |
| acide tiénilique | WHO MedNet |
| acidum tienilicum | DrugBank |
| ácido tienilico | WHO MedNet |
| Synonyms | Source |
|---|---|
| Ticrynafen | KEGG COMPOUND |
| Thienylic acid | DrugBank |
| 4-(2-Thienylketo)-2,3-dichlorophenoxyacetic acid | DrugBank |
| (2,3-Dichloro-4-(2-thiophenecarbonyl)phenoxy)acetic acid | DrugBank |
| (2,3-Dichloro-4-(2-thenoyl)phenoxy)acetic acid | DrugBank |
| 4-(2-Theonyl)-2,3-dichlorphenoxyessigsäure | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1260086 | Reaxys |
| CAS:40180-04-9 | KEGG COMPOUND |
| CAS:40180-04-9 | ChemIDplus |
| Citations |
|---|