EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8Cl2O4S |
| Net Charge | 0 |
| Average Mass | 331.176 |
| Monoisotopic Mass | 329.95204 |
| SMILES | O=C(O)COc1ccc(C(=O)c2cccs2)c(Cl)c1Cl |
| InChI | InChI=1S/C13H8Cl2O4S/c14-11-7(13(18)9-2-1-5-20-9)3-4-8(12(11)15)19-6-10(16)17/h1-5H,6H2,(H,16,17) |
| InChIKey | AGHANLSBXUWXTB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. loop diuretic A diuretic that acts on the ascending loop of Henle in the kidney. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tienilic acid (CHEBI:9590) has role antihypertensive agent (CHEBI:35674) |
| tienilic acid (CHEBI:9590) has role cardiovascular drug (CHEBI:35554) |
| tienilic acid (CHEBI:9590) has role hepatotoxic agent (CHEBI:50908) |
| tienilic acid (CHEBI:9590) has role loop diuretic (CHEBI:77608) |
| tienilic acid (CHEBI:9590) is a aromatic ether (CHEBI:35618) |
| tienilic acid (CHEBI:9590) is a aromatic ketone (CHEBI:76224) |
| tienilic acid (CHEBI:9590) is a dichlorobenzene (CHEBI:23697) |
| tienilic acid (CHEBI:9590) is a monocarboxylic acid (CHEBI:25384) |
| tienilic acid (CHEBI:9590) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| [2,3-dichloro-4-(2-thienylcarbonyl)phenoxy]acetic acid |
| INNs | Source |
|---|---|
| acide tiénilique | WHO MedNet |
| ácido tienilico | WHO MedNet |
| acidum tienilicum | DrugBank |
| tienilic acid | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (2,3-Dichloro-4-(2-thenoyl)phenoxy)acetic acid | DrugBank |
| (2,3-Dichloro-4-(2-thiophenecarbonyl)phenoxy)acetic acid | DrugBank |
| 4-(2-Theonyl)-2,3-dichlorphenoxyessigsäure | ChemIDplus |
| 4-(2-Thienylketo)-2,3-dichlorophenoxyacetic acid | DrugBank |
| SK&F 62698 | ChEMBL |
| SK&F-62698 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1260086 | Reaxys |
| CAS:40180-04-9 | KEGG COMPOUND |
| CAS:40180-04-9 | ChemIDplus |
| Citations |
|---|