EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38N2O6S |
| Net Charge | 0 |
| Average Mass | 542.698 |
| Monoisotopic Mass | 542.24506 |
| SMILES | C[C@@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(C3=CCCCC3)cc2O[C@@H]1CN(C)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C29H38N2O6S/c1-20-16-31(21(2)19-32)38(35,36)28-13-12-24(23-9-5-4-6-10-23)15-26(28)37-27(20)18-30(3)17-22-8-7-11-25(14-22)29(33)34/h7-9,11-15,20-21,27,32H,4-6,10,16-19H2,1-3H3,(H,33,34)/t20-,21+,27-/m1/s1 |
| InChIKey | FZGPYLHWXNIREJ-PBDKAQRYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[[[(4R,5S)-8-(1-cyclohexenyl)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1$l^{6},2-benzoxathiazocin-5-yl]methyl-methylamino]methyl]benzoic acid (CHEBI:95893) is a benzoic acids (CHEBI:22723) |
| Manual Xrefs | Databases |
|---|---|
| LSM-7272 | LINCS |