EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)c(O)c(OC)c(OC)c3o2)ccc1O |
| InChI | InChI=1S/C18H16O8/c1-23-12-6-8(4-5-9(12)19)11-7-10(20)13-14(21)15(22)17(24-2)18(25-3)16(13)26-11/h4-7,19,21-22H,1-3H3 |
| InChIKey | BAIRXMVFPKLWSE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mentha spicata (ncbitaxon:29719) | - | PubMed (12776552) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thymonin (CHEBI:9582) has functional parent flavone (CHEBI:42491) |
| thymonin (CHEBI:9582) has role plant metabolite (CHEBI:76924) |
| thymonin (CHEBI:9582) is a trihydroxyflavone (CHEBI:27116) |
| thymonin (CHEBI:9582) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5,6-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7,8-dimethoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| Majoranin | KNApSAcK |
| 5,6,4'-trihydroxy-7,8,3'-trimethoxyflavone | ChEBI |
| Mucroflavone B | KNApSAcK |
| 5,6-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7,8-dimethoxy-4H-1-benzopyran-4-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C10191 | KEGG COMPOUND |
| C00003931 | KNApSAcK |
| LMPK12111474 | LIPID MAPS |
| HMDB0037334 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5149201 | Reaxys |
| CAS:76844-67-2 | KEGG COMPOUND |
| Citations |
|---|