EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16O |
| Net Charge | 0 |
| Average Mass | 152.237 |
| Monoisotopic Mass | 152.12012 |
| SMILES | [H][C@]12C[C@@]1(C(C)C)CC(=O)[C@@H]2C |
| InChI | InChI=1S/C10H16O/c1-6(2)10-4-8(10)7(3)9(11)5-10/h6-8H,4-5H2,1-3H3/t7-,8-,10+/m1/s1 |
| InChIKey | USMNOWBWPHYOEA-MRTMQBJTSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-α-thujone (CHEBI:9577) is a α-thujone (CHEBI:50042) |
| (−)-α-thujone (CHEBI:9577) is enantiomer of (+)-α-thujone (CHEBI:50043) |
| Incoming Relation(s) |
| (+)-α-thujone (CHEBI:50043) is enantiomer of (−)-α-thujone (CHEBI:9577) |
| IUPAC Names |
|---|
| (1S,4R,5R)-4-methyl-1-(propan-2-yl)bicyclo[3.1.0]hexan-3-one |
| (1S,4R,5R)-thujan-3-one |
| Synonyms | Source |
|---|---|
| Thujone | KEGG COMPOUND |
| (1S,4R,5R)-1-isopropyl-4-methylbicyclo[3.1.0]hexan-3-one | IUPAC |
| (1S,4R,5R)-(−)-3-thujanone | NIST Chemistry WebBook |
| [1S-(1α,4α,5α)]-4-methyl-1-(1-methylethyl)bicyclo[3.1.0]hexan-3-one | NIST Chemistry WebBook |
| Thujon | ChemIDplus |
| (−)-3-thujanone | NIST Chemistry WebBook |
| Citations |
|---|