EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H29N3O2S2 |
| Net Charge | 0 |
| Average Mass | 443.638 |
| Monoisotopic Mass | 443.17012 |
| SMILES | CN1CCN(CC/C=C2/c3ccccc3Sc3ccc(S(=O)(=O)N(C)C)cc32)CC1 |
| InChI | InChI=1S/C23H29N3O2S2/c1-24(2)30(27,28)18-10-11-23-21(17-18)19(20-7-4-5-9-22(20)29-23)8-6-12-26-15-13-25(3)14-16-26/h4-5,7-11,17H,6,12-16H2,1-3H3/b19-8- |
| InChIKey | GFBKORZTTCHDGY-UWVJOHFNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thiothixene (CHEBI:9571) has role anticoronaviral agent (CHEBI:149553) |
| Thiothixene (CHEBI:9571) is a N-methylpiperazine (CHEBI:46920) |
| Synonyms | Source |
|---|---|
| cis-Thiothixene | DrugCentral |
| Navane (TN) | KEGG COMPOUND |
| Thiothixene | KEGG COMPOUND |
| thiothixene HCl | DrugCentral |
| thiothixene hydrochloride | DrugCentral |
| Tiotixene | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2639 | DrugCentral |
| D00374 | KEGG DRUG |
| HMDB0015560 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:3313-26-6 | DrugCentral |
| CAS:5591-45-7 | KEGG COMPOUND |