EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6N2O4 |
| Net Charge | 0 |
| Average Mass | 182.135 |
| Monoisotopic Mass | 182.03276 |
| SMILES | Cc1c([N+](=O)[O-])cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H6N2O4/c1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-4H,1H3 |
| InChIKey | XTRDKALNCIHHNI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dinitrotoluene (CHEBI:957) has role genotoxin (CHEBI:50902) |
| 2,6-dinitrotoluene (CHEBI:957) is a dinitrotoluene (CHEBI:23822) |
| IUPAC Name |
|---|
| 2-methyl-1,3-dinitrobenzene |
| Synonyms | Source |
|---|---|
| 1-methyl-2,6-dinitrobenzene | NIST Chemistry WebBook |
| 2,6-dinitromethylbenzene | ChemIDplus |
| 2,6-Dinitrotoluene | KEGG COMPOUND |
| 2,6-DNT | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 2,6-dinitrotoluene | UniProt |
| Citations |
|---|