EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO3S |
| Net Charge | 0 |
| Average Mass | 253.323 |
| Monoisotopic Mass | 253.07726 |
| SMILES | O=C(O)CNC(=O)C(CS)Cc1ccccc1 |
| InChI | InChI=1S/C12H15NO3S/c14-11(15)7-13-12(16)10(8-17)6-9-4-2-1-3-5-9/h1-5,10,17H,6-8H2,(H,13,16)(H,14,15) |
| InChIKey | LJJKNPQAGWVLDQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thiorphan (CHEBI:9568) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| Thiorphan | KEGG COMPOUND |