EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9555 - tioguanine
| Formula | C5H5N5S |
| Net Charge | 0 |
| Average Mass | 167.197 |
| Monoisotopic Mass | 167.02657 |
| SMILES | Nc1nc(=S)c2ncnc2n1 |
| InChI | InChI=1S/C5H5N5S/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11) |
| InChIKey | WYWHKKSPHMUBEB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tioguanine (CHEBI:9555) has role anticoronaviral agent (CHEBI:149553) |
| tioguanine (CHEBI:9555) has role antimetabolite (CHEBI:35221) |
| tioguanine (CHEBI:9555) has role antineoplastic agent (CHEBI:35610) |
| tioguanine (CHEBI:9555) is a 2-aminopurines (CHEBI:20702) |
| Incoming Relation(s) |
| 6-methylthioguanine (CHEBI:140528) has functional parent tioguanine (CHEBI:9555) |
| IUPAC Name |
|---|
| 2-amino-1,9-dihydro-6H-purine-6-thione |
| INNs | Source |
|---|---|
| tioguanine | KEGG DRUG |
| tioguaninum | ChemIDplus |
| tioguanina | ChemIDplus |
| tioguanine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Thioguanine | KEGG COMPOUND |
| 2-amino-1,9-dihydropurine-6-thione | PDBeChem |
| 2-Aminopurine-6-thiol | DrugBank |
| 2-Aminopurin-6-thiol | DrugBank |
| 2-Amino-6-purinethiol | DrugBank |
| 6-Mercaptoguanine | DrugBank |
| UniProt Name | Source |
|---|---|
| 6-thioguanine | UniProt |
| Citations |
|---|