EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O3 |
| Net Charge | 0 |
| Average Mass | 154.165 |
| Monoisotopic Mass | 154.06299 |
| SMILES | COc1cccc(OC)c1O |
| InChI | InChI=1S/C8H10O3/c1-10-6-4-3-5-7(11-2)8(6)9/h3-5,9H,1-2H3 |
| InChIKey | KLIDCXVFHGNTTM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Panax japonicus var. major (ncbitaxon:45211) | root (BTO:0001188) | PubMed (21417387) | Ethanolic extract of dried and pulverized roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,6-dimethoxyphenol (CHEBI:955) has role plant metabolite (CHEBI:76924) |
| 2,6-dimethoxyphenol (CHEBI:955) is a dimethoxybenzene (CHEBI:51681) |
| 2,6-dimethoxyphenol (CHEBI:955) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| 2-(4-hydroxy-3,5-dimethoxyphenyl)-3-(hydroxymethyl)-2,3-dihydro-7H-pyrano[2,3-g][1,4]benzodioxin-7-one (CHEBI:91204) has functional parent 2,6-dimethoxyphenol (CHEBI:955) |
| IUPAC Name |
|---|
| 2,6-dimethoxyphenol |
| Synonyms | Source |
|---|---|
| 1,3-di-O-methylpyrogallol | ChemIDplus |
| 1,3-dimethoxy-2-hydroxybenzene | ChemIDplus |
| 1,3-dimethyl pyrogallate | NIST Chemistry WebBook |
| 2,6-Dimethoxyphenol | KEGG COMPOUND |
| 2-hydroxy-1,3-dimethoxybenzene | ChemIDplus |
| Pyrogallol 1,3-dimethyl ether | KEGG COMPOUND |
| Citations |
|---|