EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O2S |
| Net Charge | 0 |
| Average Mass | 254.355 |
| Monoisotopic Mass | 254.10890 |
| SMILES | C=CCC1(C(C)CCC)C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C12H18N2O2S/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17) |
| InChIKey | XLOMZPUITCYLMJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| Applications: | sedative A central nervous system depressant used to induce drowsiness or sleep or to reduce psychological excitement or anxiety. GABA modulator A substance that does not act as agonist or antagonist but does affect the gamma-aminobutyric acid receptor-ionophore complex. GABA-A receptors appear to have at least three allosteric sites at which modulators act: a site at which benzodiazepines act by increasing the opening frequency of gamma-aminobutyric acid-activated chloride channels; a site at which barbiturates act to prolong the duration of channel opening; and a site at which some steroids may act. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiamylal (CHEBI:9536) has role sedative (CHEBI:35717) |
| thiamylal (CHEBI:9536) is a barbiturates (CHEBI:22693) |
| thiamylal (CHEBI:9536) is a organosulfur compound (CHEBI:33261) |
| IUPAC Name |
|---|
| 5-(pentan-2-yl)-5-(prop-2-en-1-yl)-2-sulfanylidenedihydropyrimidine-4,6(1H,5H)-dione |
| Synonyms | Source |
|---|---|
| 5-Allyl-5-(1-methylbutyl)-2-thiobarbituric acid | KEGG COMPOUND |
| 5-allyl-5-(1-methylbutyl)-2-thioxodihydro-4,6(1H,5H)-pyrimidinedione | NIST Chemistry WebBook |
| 5-allyl-5-(1-methylbutyl)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione | IUPAC |
| dihydro-5-(1-methylbutyl)-5-(2-propenyl)-2-thioxo-4,6(1H,5H)-pyrimidinedione | NIST Chemistry WebBook |
| Thiamylal | KEGG COMPOUND |
| thioseconal | ChemIDplus |
| Citations |
|---|